ChemNet > CAS > 26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
Nama produk |
2-[(4-chlorophenyl)thio]-3-nitropyridine |
Sinonim |
2-[(4-chlorophenyl)sulfanyl]-3-nitropyridine |
MF |
C11H7ClN2O2S |
Berat Molekul |
266.7035 |
InChI |
InChI=1/C11H7ClN2O2S/c12-8-3-5-9(6-4-8)17-11-10(14(15)16)2-1-7-13-11/h1-7H |
CAS NO |
26820-31-5 |
Struktur Molekul |
|
Kepadatan |
1.47g/cm3 |
Titik lebur |
127℃ |
Titik didih |
398.4°C at 760 mmHg |
Indeks bias |
1.68 |
Titik nyala |
194.8°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|